C17H23N3OS5 — CID 3717991
[2-oxo-2-[[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]amino]ethyl] N,N-dimethylcarbamodithioate (PubChem CID 3717991) has the molecular formula C17H23N3OS5 and a molecular weight of 445.73 g/mol. Its IUPAC name is [2-oxo-2-[[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]amino]ethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-oxo-2-[[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]amino]ethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 3717991 |
| Molecular Formula | C17H23N3OS5 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | [2-oxo-2-[[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]amino]ethyl] N,N-dimethylcarbamodithioate |
| SMILES | CC(C)SCCSc1nc2ccc(NC(=O)CSC(=S)N(C)C)cc2s1 |
| InChI | InChI=1S/C17H23N3OS5/c1-11(2)23-7-8-24-16-19-13-6-5-12(9-14(13)26-16)18-15(21)10-25-17(22)20(3)4/h5-6,9,11H,7-8,10H2,1-4H3,(H,18,21) |
| InChIKey | QEMFCCJNGMFBIX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|