C17H19N3OS3 — CID 3746072
1-cyano-N-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]cyclopropane-1-carboxamide (PubChem CID 3746072) has the molecular formula C17H19N3OS3 and a molecular weight of 377.56 g/mol. Its IUPAC name is 1-cyano-N-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-cyano-N-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 3746072 |
| Molecular Formula | C17H19N3OS3 |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 1-cyano-N-[2-(2-propan-2-ylsulfanylethylsulfanyl)-1,3-benzothiazol-6-yl]cyclopropane-1-carboxamide |
| SMILES | CC(C)SCCSc1nc2ccc(NC(=O)C3(C#N)CC3)cc2s1 |
| InChI | InChI=1S/C17H19N3OS3/c1-11(2)22-7-8-23-16-20-13-4-3-12(9-14(13)24-16)19-15(21)17(10-18)5-6-17/h3-4,9,11H,5-8H2,1-2H3,(H,19,21) |
| InChIKey | FLPIHYAHZZSRAD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|