C16H15N3OS — CID 42733059
1-benzyl-3-(6-methyl-1,3-benzothiazol-2-yl)urea (PubChem CID 42733059) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-benzyl-3-(6-methyl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-benzyl-3-(6-methyl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 42733059 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-benzyl-3-(6-methyl-1,3-benzothiazol-2-yl)urea |
| SMILES | Cc1ccc2nc(NC(=O)NCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C16H15N3OS/c1-11-7-8-13-14(9-11)21-16(18-13)19-15(20)17-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H2,17,18,19,20) |
| InChIKey | HXVCSIKUFDKZQQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |