C17H17N3OS — CID 121080904
1-benzyl-3-(5,7-dimethyl-1,3-benzothiazol-2-yl)urea (PubChem CID 121080904) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-benzyl-3-(5,7-dimethyl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-benzyl-3-(5,7-dimethyl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121080904 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-benzyl-3-(5,7-dimethyl-1,3-benzothiazol-2-yl)urea |
| SMILES | Cc1cc(C)c2sc(NC(=O)NCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C17H17N3OS/c1-11-8-12(2)15-14(9-11)19-17(22-15)20-16(21)18-10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | KLZCPIKVSJLRMZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |