C12H15N3OS — CID 121082538
1-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3-ethylurea (PubChem CID 121082538) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3-ethylurea.
| Compound Name | 1-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3-ethylurea |
|---|---|
| PubChem CID | 121082538 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 1-(5,7-dimethyl-1,3-benzothiazol-2-yl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2cc(C)cc(C)c2s1 |
| InChI | InChI=1S/C12H15N3OS/c1-4-13-11(16)15-12-14-9-6-7(2)5-8(3)10(9)17-12/h5-6H,4H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | WINLRFKDNVTBFQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |