C20H28N4OS — CID 143598440
ethane;1-ethyl-3-(7-methyl-5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea (PubChem CID 143598440) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is ethane;1-ethyl-3-(7-methyl-5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea.
| Compound Name | ethane;1-ethyl-3-(7-methyl-5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 143598440 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | ethane;1-ethyl-3-(7-methyl-5-pyridin-3-yl-1,3-benzothiazol-2-yl)urea |
| SMILES | CC.CC.CCNC(=O)Nc1nc2cc(-c3cccnc3)cc(C)c2s1 |
| InChI | InChI=1S/C16H16N4OS.2C2H6/c1-3-18-15(21)20-16-19-13-8-12(7-10(2)14(13)22-16)11-5-4-6-17-9-11;2*1-2/h4-9H,3H2,1-2H3,(H2,18,19,20,21);2*1-2H3 |
| InChIKey | GMRGJFWYNHCIFI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |