C22H29BN4O3S — CID 143598428
1-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-pyridin-3-yl-1,3-benzothiazol-2-yl]-3-ethylurea;ethane (PubChem CID 143598428) has the molecular formula C22H29BN4O3S and a molecular weight of 440.38 g/mol. Its IUPAC name is 1-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-pyridin-3-yl-1,3-benzothiazol-2-yl]-3-ethylurea;ethane.
| Compound Name | 1-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-pyridin-3-yl-1,3-benzothiazol-2-yl]-3-ethylurea;ethane |
|---|---|
| PubChem CID | 143598428 |
| Molecular Formula | C22H29BN4O3S |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-7-pyridin-3-yl-1,3-benzothiazol-2-yl]-3-ethylurea;ethane |
| SMILES | CC.CCNC(=O)Nc1nc2cc(B3OCC(C)(C)CO3)cc(-c3cccnc3)c2s1 |
| InChI | InChI=1S/C20H23BN4O3S.C2H6/c1-4-23-18(26)25-19-24-16-9-14(21-27-11-20(2,3)12-28-21)8-15(17(16)29-19)13-6-5-7-22-10-13;1-2/h5-10H,4,11-12H2,1-3H3,(H2,23,24,25,26);1-2H3 |
| InChIKey | VNLJXOFCUAUZLM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|