About 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea
1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea (PubChem CID 24864583) has the molecular formula C22H20N4O2S
and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea |
| PubChem CID | 24864583 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2cc(-c3ccc(CO)cc3)cc(-c3cccnc3)c2s1 |
| InChI | InChI=1S/C22H20N4O2S/c1-2-24-21(28)26-22-25-19-11-17(15-7-5-14(13-27)6-8-15)10-18(20(19)29-22)16-4-3-9-23-12-16/h3-12,27H,2,13H2,1H3,(H2,24,25,26,28) |
| InChIKey | HYOAZHFLYJHNKJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea?
The IUPAC name of 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea (CID 24864583) is 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea.
What is the SMILES notation for 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea?
The canonical SMILES for 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea is CCNC(=O)Nc1nc2cc(-c3ccc(CO)cc3)cc(-c3cccnc3)c2s1.
What is the InChIKey of 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea?
The InChIKey is HYOAZHFLYJHNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O2S/c1-2-24-21(28)26-22-25-19-11-17(15-7-5-14(13-27)6-8-15)10-18(20(19)29-22)16-4-3-9-23-12-16/h3-12,27H,2,13H2,1H3,(H2,24,25,26,28).
What are the key properties of 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea?
1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea has a molecular weight of 404.50 g/mol, XLogP of 4.66, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[5-[4-(hydroxymethyl)phenyl]-7-pyridin-3-yl-1,3-benzothiazol-2-yl]urea is sourced from PubChem (CID 24864583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).