C18H16N6OS — CID 24864398
1-ethyl-3-(5-pyrazol-1-yl-7-pyridin-3-yl-1,3-benzothiazol-2-yl)urea (PubChem CID 24864398) has the molecular formula C18H16N6OS and a molecular weight of 364.43 g/mol. Its IUPAC name is 1-ethyl-3-(5-pyrazol-1-yl-7-pyridin-3-yl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-ethyl-3-(5-pyrazol-1-yl-7-pyridin-3-yl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 24864398 |
| Molecular Formula | C18H16N6OS |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-ethyl-3-(5-pyrazol-1-yl-7-pyridin-3-yl-1,3-benzothiazol-2-yl)urea |
| SMILES | CCNC(=O)Nc1nc2cc(-n3cccn3)cc(-c3cccnc3)c2s1 |
| InChI | InChI=1S/C18H16N6OS/c1-2-20-17(25)23-18-22-15-10-13(24-8-4-7-21-24)9-14(16(15)26-18)12-5-3-6-19-11-12/h3-11H,2H2,1H3,(H2,20,22,23,25) |
| InChIKey | NXSFAKLMWJRZFT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |