C15H14BrN5O2S — CID 141332443
1-(7-bromo-6-methoxy-5-pyrimidin-5-yl-1,3-benzothiazol-2-yl)-3-ethylurea (PubChem CID 141332443) has the molecular formula C15H14BrN5O2S and a molecular weight of 408.28 g/mol. Its IUPAC name is 1-(7-bromo-6-methoxy-5-pyrimidin-5-yl-1,3-benzothiazol-2-yl)-3-ethylurea.
| Compound Name | 1-(7-bromo-6-methoxy-5-pyrimidin-5-yl-1,3-benzothiazol-2-yl)-3-ethylurea |
|---|---|
| PubChem CID | 141332443 |
| Molecular Formula | C15H14BrN5O2S |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 1-(7-bromo-6-methoxy-5-pyrimidin-5-yl-1,3-benzothiazol-2-yl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1nc2cc(-c3cncnc3)c(OC)c(Br)c2s1 |
| InChI | InChI=1S/C15H14BrN5O2S/c1-3-19-14(22)21-15-20-10-4-9(8-5-17-7-18-6-8)12(23-2)11(16)13(10)24-15/h4-7H,3H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | OUTSMGCTLBXAMC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |