C13H16N2O5S — CID 3510327
ethyl N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)carbamate (PubChem CID 3510327) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is ethyl N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)carbamate.
| Compound Name | ethyl N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 3510327 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | ethyl N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)carbamate |
| SMILES | CCOC(=O)Nc1nc2cc(OC)c(OC)c(OC)c2s1 |
| InChI | InChI=1S/C13H16N2O5S/c1-5-20-13(16)15-12-14-7-6-8(17-2)9(18-3)10(19-4)11(7)21-12/h6H,5H2,1-4H3,(H,14,15,16) |
| InChIKey | FUJBDYFCRBDDRE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |