C13H12N2O5S — CID 167718002
5-methoxy-2-(prop-2-enoxycarbonylamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 167718002) has the molecular formula C13H12N2O5S and a molecular weight of 308.32 g/mol. Its IUPAC name is 5-methoxy-2-(prop-2-enoxycarbonylamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 5-methoxy-2-(prop-2-enoxycarbonylamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 167718002 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 5-methoxy-2-(prop-2-enoxycarbonylamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | C=CCOC(=O)Nc1nc2cc(OC)c(C(=O)O)cc2s1 |
| InChI | InChI=1S/C13H12N2O5S/c1-3-4-20-13(18)15-12-14-8-6-9(19-2)7(11(16)17)5-10(8)21-12/h3,5-6H,1,4H2,2H3,(H,16,17)(H,14,15,18) |
| InChIKey | KEFWBMJRXHTHPC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|