C17H16N2O3S — CID 82548344
5-methoxy-2-(2-phenylethylamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 82548344) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 5-methoxy-2-(2-phenylethylamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 5-methoxy-2-(2-phenylethylamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 82548344 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 5-methoxy-2-(2-phenylethylamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | COc1cc2nc(NCCc3ccccc3)sc2cc1C(=O)O |
| InChI | InChI=1S/C17H16N2O3S/c1-22-14-10-13-15(9-12(14)16(20)21)23-17(19-13)18-8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | MHUFKNZBIZQGHG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |