C17H18N2O2S — CID 82549487
4,7-dimethoxy-N-(2-phenylethyl)-1,3-benzothiazol-2-amine (PubChem CID 82549487) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4,7-dimethoxy-N-(2-phenylethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 4,7-dimethoxy-N-(2-phenylethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549487 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4,7-dimethoxy-N-(2-phenylethyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc(OC)c2sc(NCCc3ccccc3)nc12 |
| InChI | InChI=1S/C17H18N2O2S/c1-20-13-8-9-14(21-2)16-15(13)19-17(22-16)18-11-10-12-6-4-3-5-7-12/h3-9H,10-11H2,1-2H3,(H,18,19) |
| InChIKey | VJPDQWIFQUICFW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |