C17H18N2OS — CID 82549040
N-benzyl-6-methoxy-4,7-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 82549040) has the molecular formula C17H18N2OS and a molecular weight of 298.41 g/mol. Its IUPAC name is N-benzyl-6-methoxy-4,7-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | N-benzyl-6-methoxy-4,7-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549040 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-benzyl-6-methoxy-4,7-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(C)c2nc(NCc3ccccc3)sc2c1C |
| InChI | InChI=1S/C17H18N2OS/c1-11-9-14(20-3)12(2)16-15(11)19-17(21-16)18-10-13-7-5-4-6-8-13/h4-9H,10H2,1-3H3,(H,18,19) |
| InChIKey | MZSSNSIHXJRQHS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |