C18H20N2OS — CID 82548811
N-benzyl-4-methyl-6-propoxy-1,3-benzothiazol-2-amine (PubChem CID 82548811) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is N-benzyl-4-methyl-6-propoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-benzyl-4-methyl-6-propoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82548811 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-benzyl-4-methyl-6-propoxy-1,3-benzothiazol-2-amine |
| SMILES | CCCOc1cc(C)c2nc(NCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C18H20N2OS/c1-3-9-21-15-10-13(2)17-16(11-15)22-18(20-17)19-12-14-7-5-4-6-8-14/h4-8,10-11H,3,9,12H2,1-2H3,(H,19,20) |
| InChIKey | URFVZNSPFRSMFR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |