C18H20N2O2S — CID 82549644
N-benzyl-4,6-diethoxy-1,3-benzothiazol-2-amine (PubChem CID 82549644) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-benzyl-4,6-diethoxy-1,3-benzothiazol-2-amine.
| Compound Name | N-benzyl-4,6-diethoxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549644 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-benzyl-4,6-diethoxy-1,3-benzothiazol-2-amine |
| SMILES | CCOc1cc(OCC)c2nc(NCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-3-21-14-10-15(22-4-2)17-16(11-14)23-18(20-17)19-12-13-8-6-5-7-9-13/h5-11H,3-4,12H2,1-2H3,(H,19,20) |
| InChIKey | YBFDXIXMKUOJTR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |