C17H17N3OS — CID 133317329
N-[(3-ethoxyphenyl)methyl]-3-phenyl-1,2,4-thiadiazol-5-amine (PubChem CID 133317329) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is N-[(3-ethoxyphenyl)methyl]-3-phenyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[(3-ethoxyphenyl)methyl]-3-phenyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133317329 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-[(3-ethoxyphenyl)methyl]-3-phenyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCOc1cccc(CNc2nc(-c3ccccc3)ns2)c1 |
| InChI | InChI=1S/C17H17N3OS/c1-2-21-15-10-6-7-13(11-15)12-18-17-19-16(20-22-17)14-8-4-3-5-9-14/h3-11H,2,12H2,1H3,(H,18,19,20) |
| InChIKey | VZNVQLSUVGXYHY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |