C16H12N4S — CID 133407141
3-[[(3-phenyl-1,2,4-thiadiazol-5-yl)amino]methyl]benzonitrile (PubChem CID 133407141) has the molecular formula C16H12N4S and a molecular weight of 292.37 g/mol. Its IUPAC name is 3-[[(3-phenyl-1,2,4-thiadiazol-5-yl)amino]methyl]benzonitrile.
| Compound Name | 3-[[(3-phenyl-1,2,4-thiadiazol-5-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 133407141 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 3-[[(3-phenyl-1,2,4-thiadiazol-5-yl)amino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNc2nc(-c3ccccc3)ns2)c1 |
| InChI | InChI=1S/C16H12N4S/c17-10-12-5-4-6-13(9-12)11-18-16-19-15(20-21-16)14-7-2-1-3-8-14/h1-9H,11H2,(H,18,19,20) |
| InChIKey | YIHIOHOWXJRTDP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |