C12H9N3O2S — CID 80571600
2-[(3-cyanophenyl)methylamino]-1,3-thiazole-5-carboxylic acid (PubChem CID 80571600) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-[(3-cyanophenyl)methylamino]-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(3-cyanophenyl)methylamino]-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80571600 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 2-[(3-cyanophenyl)methylamino]-1,3-thiazole-5-carboxylic acid |
| SMILES | N#Cc1cccc(CNc2ncc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C12H9N3O2S/c13-5-8-2-1-3-9(4-8)6-14-12-15-7-10(18-12)11(16)17/h1-4,7H,6H2,(H,14,15)(H,16,17) |
| InChIKey | YRDOCJKHUWSQPS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |