C12H9N3O2S — CID 80571651
methyl 2-(3-cyanoanilino)-1,3-thiazole-5-carboxylate (PubChem CID 80571651) has the molecular formula C12H9N3O2S and a molecular weight of 259.29 g/mol. Its IUPAC name is methyl 2-(3-cyanoanilino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(3-cyanoanilino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80571651 |
| Molecular Formula | C12H9N3O2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | methyl 2-(3-cyanoanilino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C12H9N3O2S/c1-17-11(16)10-7-14-12(18-10)15-9-4-2-3-8(5-9)6-13/h2-5,7H,1H3,(H,14,15) |
| InChIKey | NOTSRDIQNBGQMM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |