C12H8FN3O2S — CID 80571491
methyl 2-(3-cyano-4-fluoroanilino)-1,3-thiazole-5-carboxylate (PubChem CID 80571491) has the molecular formula C12H8FN3O2S and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 2-(3-cyano-4-fluoroanilino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(3-cyano-4-fluoroanilino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80571491 |
| Molecular Formula | C12H8FN3O2S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | methyl 2-(3-cyano-4-fluoroanilino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(Nc2ccc(F)c(C#N)c2)s1 |
| InChI | InChI=1S/C12H8FN3O2S/c1-18-11(17)10-6-15-12(19-10)16-8-2-3-9(13)7(4-8)5-14/h2-4,6H,1H3,(H,15,16) |
| InChIKey | YWWPXKXFHBDZOR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |