C13H7ClN4O2S — CID 107792352
methyl 4-chloro-2-(3,4-dicyanoanilino)-1,3-thiazole-5-carboxylate (PubChem CID 107792352) has the molecular formula C13H7ClN4O2S and a molecular weight of 318.75 g/mol. Its IUPAC name is methyl 4-chloro-2-(3,4-dicyanoanilino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(3,4-dicyanoanilino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 107792352 |
| Molecular Formula | C13H7ClN4O2S |
| Molecular Weight | 318.75 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | methyl 4-chloro-2-(3,4-dicyanoanilino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(Nc2ccc(C#N)c(C#N)c2)nc1Cl |
| InChI | InChI=1S/C13H7ClN4O2S/c1-20-12(19)10-11(14)18-13(21-10)17-9-3-2-7(5-15)8(4-9)6-16/h2-4H,1H3,(H,17,18) |
| InChIKey | RBPIRLFDVBDLBM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.75 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |