C11H7BrClIN2O2S — CID 114261157
methyl 2-(4-bromo-3-iodoanilino)-4-chloro-1,3-thiazole-5-carboxylate (PubChem CID 114261157) has the molecular formula C11H7BrClIN2O2S and a molecular weight of 473.52 g/mol. Its IUPAC name is methyl 2-(4-bromo-3-iodoanilino)-4-chloro-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(4-bromo-3-iodoanilino)-4-chloro-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 114261157 |
| Molecular Formula | C11H7BrClIN2O2S |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 471.81 |
| IUPAC Name | methyl 2-(4-bromo-3-iodoanilino)-4-chloro-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(Nc2ccc(Br)c(I)c2)nc1Cl |
| InChI | InChI=1S/C11H7BrClIN2O2S/c1-18-10(17)8-9(13)16-11(19-8)15-5-2-3-6(12)7(14)4-5/h2-4H,1H3,(H,15,16) |
| InChIKey | MHDYOCHDFQGEAA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|