C12H10BrIN2O2S — CID 114261659
methyl 2-(4-bromo-3-iodoanilino)-5-methyl-1,3-thiazole-4-carboxylate (PubChem CID 114261659) has the molecular formula C12H10BrIN2O2S and a molecular weight of 453.10 g/mol. Its IUPAC name is methyl 2-(4-bromo-3-iodoanilino)-5-methyl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-(4-bromo-3-iodoanilino)-5-methyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 114261659 |
| Molecular Formula | C12H10BrIN2O2S |
| Molecular Weight | 453.10 g/mol |
| Exact Mass | 451.87 |
| IUPAC Name | methyl 2-(4-bromo-3-iodoanilino)-5-methyl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(Nc2ccc(Br)c(I)c2)sc1C |
| InChI | InChI=1S/C12H10BrIN2O2S/c1-6-10(11(17)18-2)16-12(19-6)15-7-3-4-8(13)9(14)5-7/h3-5H,1-2H3,(H,15,16) |
| InChIKey | LUGMVTDPMILIAG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.10 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|