C13H8N4O2S — CID 107794681
2-(3,4-dicyanoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 107794681) has the molecular formula C13H8N4O2S and a molecular weight of 284.30 g/mol. Its IUPAC name is 2-(3,4-dicyanoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(3,4-dicyanoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107794681 |
| Molecular Formula | C13H8N4O2S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-(3,4-dicyanoanilino)-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(Nc2ccc(C#N)c(C#N)c2)sc1C(=O)O |
| InChI | InChI=1S/C13H8N4O2S/c1-7-11(12(18)19)20-13(16-7)17-10-3-2-8(5-14)9(4-10)6-15/h2-4H,1H3,(H,16,17)(H,18,19) |
| InChIKey | HLYJFUYHEUEFGF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |