C21H18N4OS2 — CID 87664196
bis(2-anilino-4-methyl-1,3-thiazol-5-yl)methanone (PubChem CID 87664196) has the molecular formula C21H18N4OS2 and a molecular weight of 406.54 g/mol. Its IUPAC name is bis(2-anilino-4-methyl-1,3-thiazol-5-yl)methanone.
| Compound Name | bis(2-anilino-4-methyl-1,3-thiazol-5-yl)methanone |
|---|---|
| PubChem CID | 87664196 |
| Molecular Formula | C21H18N4OS2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | bis(2-anilino-4-methyl-1,3-thiazol-5-yl)methanone |
| SMILES | Cc1nc(Nc2ccccc2)sc1C(=O)c1sc(Nc2ccccc2)nc1C |
| InChI | InChI=1S/C21H18N4OS2/c1-13-18(27-20(22-13)24-15-9-5-3-6-10-15)17(26)19-14(2)23-21(28-19)25-16-11-7-4-8-12-16/h3-12H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | KDYQWNNQCGZOSQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |