About 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane
1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane (PubChem CID 144672585) has the molecular formula C15H20N2OS
and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane.
Molecular Properties
| Compound Name | 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane |
| PubChem CID | 144672585 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane |
| SMILES | CC.CCC(=O)c1sc(Nc2ccccc2)nc1C |
| InChI | InChI=1S/C13H14N2OS.C2H6/c1-3-11(16)12-9(2)14-13(17-12)15-10-7-5-4-6-8-10;1-2/h4-8H,3H2,1-2H3,(H,14,15);1-2H3 |
| InChIKey | ALCITPVYMNJXTF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane?
The IUPAC name of 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane (CID 144672585) is 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane.
What is the SMILES notation for 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane?
The canonical SMILES for 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane is CC.CCC(=O)c1sc(Nc2ccccc2)nc1C.
What is the InChIKey of 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane?
The InChIKey is ALCITPVYMNJXTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2OS.C2H6/c1-3-11(16)12-9(2)14-13(17-12)15-10-7-5-4-6-8-10;1-2/h4-8H,3H2,1-2H3,(H,14,15);1-2H3.
What are the key properties of 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane?
1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane has a molecular weight of 276.41 g/mol, XLogP of 4.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-anilino-4-methyl-1,3-thiazol-5-yl)propan-1-one;ethane is sourced from PubChem (CID 144672585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).