C12H12N2O2S — CID 169101363
1-[2-(4-hydroxyanilino)-4-methyl-1,3-thiazol-5-yl]ethanone (PubChem CID 169101363) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 1-[2-(4-hydroxyanilino)-4-methyl-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(4-hydroxyanilino)-4-methyl-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 169101363 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1-[2-(4-hydroxyanilino)-4-methyl-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1sc(Nc2ccc(O)cc2)nc1C |
| InChI | InChI=1S/C12H12N2O2S/c1-7-11(8(2)15)17-12(13-7)14-9-3-5-10(16)6-4-9/h3-6,16H,1-2H3,(H,13,14) |
| InChIKey | UXTNVQUBBMWAKY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|