C16H19N3O2S — CID 35281693
1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)urea (PubChem CID 35281693) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 35281693 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(=O)c1sc(NC(=O)Nc2ccc(C(C)C)cc2)nc1C |
| InChI | InChI=1S/C16H19N3O2S/c1-9(2)12-5-7-13(8-6-12)18-15(21)19-16-17-10(3)14(22-16)11(4)20/h5-9H,1-4H3,(H2,17,18,19,21) |
| InChIKey | HHLYPAPZHWMPKU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |