C12H8F2N2O3S — CID 18103744
methyl 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 18103744) has the molecular formula C12H8F2N2O3S and a molecular weight of 298.27 g/mol. Its IUPAC name is methyl 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18103744 |
| Molecular Formula | C12H8F2N2O3S |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | methyl 2-[(3,4-difluorobenzoyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NC(=O)c2ccc(F)c(F)c2)s1 |
| InChI | InChI=1S/C12H8F2N2O3S/c1-19-11(18)9-5-15-12(20-9)16-10(17)6-2-3-7(13)8(14)4-6/h2-5H,1H3,(H,15,16,17) |
| InChIKey | WUYOEJZJJKRNBQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |