C12H9ClN2O3S — CID 18103549
methyl 2-[(4-chlorobenzoyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 18103549) has the molecular formula C12H9ClN2O3S and a molecular weight of 296.74 g/mol. Its IUPAC name is methyl 2-[(4-chlorobenzoyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(4-chlorobenzoyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 18103549 |
| Molecular Formula | C12H9ClN2O3S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | methyl 2-[(4-chlorobenzoyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C12H9ClN2O3S/c1-18-11(17)9-6-14-12(19-9)15-10(16)7-2-4-8(13)5-3-7/h2-6H,1H3,(H,14,15,16) |
| InChIKey | FHCUIQSGJDKAGS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |