C11H7ClN2O2S — CID 71423986
4-chloro-N-(5-formyl-1,3-thiazol-2-yl)benzamide (PubChem CID 71423986) has the molecular formula C11H7ClN2O2S and a molecular weight of 266.71 g/mol. Its IUPAC name is 4-chloro-N-(5-formyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-chloro-N-(5-formyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 71423986 |
| Molecular Formula | C11H7ClN2O2S |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 4-chloro-N-(5-formyl-1,3-thiazol-2-yl)benzamide |
| SMILES | O=Cc1cnc(NC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C11H7ClN2O2S/c12-8-3-1-7(2-4-8)10(16)14-11-13-5-9(6-15)17-11/h1-6H,(H,13,14,16) |
| InChIKey | NFLUSJMHLBZJDB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|