C24H19ClN2O2S — CID 3974923
N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-phenylmethoxybenzamide (PubChem CID 3974923) has the molecular formula C24H19ClN2O2S and a molecular weight of 434.95 g/mol. Its IUPAC name is N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-phenylmethoxybenzamide.
| Compound Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 3974923 |
| Molecular Formula | C24H19ClN2O2S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[5-[(4-chlorophenyl)methyl]-1,3-thiazol-2-yl]-4-phenylmethoxybenzamide |
| SMILES | O=C(Nc1ncc(Cc2ccc(Cl)cc2)s1)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H19ClN2O2S/c25-20-10-6-17(7-11-20)14-22-15-26-24(30-22)27-23(28)19-8-12-21(13-9-19)29-16-18-4-2-1-3-5-18/h1-13,15H,14,16H2,(H,26,27,28) |
| InChIKey | MLQXBYNTDCOOCV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |