C14H9N3O3S — CID 76907763
3-[2-[(4-cyanobenzoyl)amino]-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 76907763) has the molecular formula C14H9N3O3S and a molecular weight of 299.31 g/mol. Its IUPAC name is 3-[2-[(4-cyanobenzoyl)amino]-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-[(4-cyanobenzoyl)amino]-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907763 |
| Molecular Formula | C14H9N3O3S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-[2-[(4-cyanobenzoyl)amino]-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | N#Cc1ccc(C(=O)Nc2ncc(C=CC(=O)O)s2)cc1 |
| InChI | InChI=1S/C14H9N3O3S/c15-7-9-1-3-10(4-2-9)13(20)17-14-16-8-11(21-14)5-6-12(18)19/h1-6,8H,(H,18,19)(H,16,17,20) |
| InChIKey | URVNWDNCDOWPPX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|