C12H9N3O3S — CID 109374911
(E)-3-[2-(pyridine-3-carbonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 109374911) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is (E)-3-[2-(pyridine-3-carbonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(pyridine-3-carbonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109374911 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (E)-3-[2-(pyridine-3-carbonylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc(NC(=O)c2cccnc2)s1 |
| InChI | InChI=1S/C12H9N3O3S/c16-10(17)4-3-9-7-14-12(19-9)15-11(18)8-2-1-5-13-6-8/h1-7H,(H,16,17)(H,14,15,18)/b4-3+ |
| InChIKey | LMTFMGSYBVIXRP-ONEGZZNKSA-N |
| XLogP | 1.89 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|