C16H14N2O3 — CID 76907410
3-[4-methyl-3-(pyridine-3-carbonylamino)phenyl]prop-2-enoic acid (PubChem CID 76907410) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-[4-methyl-3-(pyridine-3-carbonylamino)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-methyl-3-(pyridine-3-carbonylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907410 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-[4-methyl-3-(pyridine-3-carbonylamino)phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(C=CC(=O)O)cc1NC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H14N2O3/c1-11-4-5-12(6-7-15(19)20)9-14(11)18-16(21)13-3-2-8-17-10-13/h2-10H,1H3,(H,18,21)(H,19,20) |
| InChIKey | LLWITMIUOSFESS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|