C14H8BrClN4OS2 — CID 3354063
N-[5-[(5-bromothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide (PubChem CID 3354063) has the molecular formula C14H8BrClN4OS2 and a molecular weight of 427.74 g/mol. Its IUPAC name is N-[5-[(5-bromothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide.
| Compound Name | N-[5-[(5-bromothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 3354063 |
| Molecular Formula | C14H8BrClN4OS2 |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | N-[5-[(5-bromothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]-4-chlorobenzamide |
| SMILES | O=C(Nc1nnc(N=Cc2ccc(Br)s2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H8BrClN4OS2/c15-11-6-5-10(22-11)7-17-13-19-20-14(23-13)18-12(21)8-1-3-9(16)4-2-8/h1-7H,(H,18,20,21) |
| InChIKey | PQBMTMGMALAKQZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|