C17H15N5O6S2 — CID 45022644
3,4,5-trimethoxy-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 45022644) has the molecular formula C17H15N5O6S2 and a molecular weight of 449.47 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 45022644 |
| Molecular Formula | C17H15N5O6S2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nnc(/N=C/c3ccc([N+](=O)[O-])s3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C17H15N5O6S2/c1-26-11-6-9(7-12(27-2)14(11)28-3)15(23)19-17-21-20-16(30-17)18-8-10-4-5-13(29-10)22(24)25/h4-8H,1-3H3,(H,19,21,23)/b18-8+ |
| InChIKey | QLCBVSDKUQASTL-QGMBQPNBSA-N |
| XLogP | 3.54 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|