C18H18N6O5S3 — CID 46494973
4-(diethylsulfamoyl)-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 46494973) has the molecular formula C18H18N6O5S3 and a molecular weight of 494.58 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46494973 |
| Molecular Formula | C18H18N6O5S3 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[5-[(E)-(5-nitrothiophen-2-yl)methylideneamino]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nnc(/N=C/c3ccc([N+](=O)[O-])s3)s2)cc1 |
| InChI | InChI=1S/C18H18N6O5S3/c1-3-23(4-2)32(28,29)14-8-5-12(6-9-14)16(25)20-18-22-21-17(31-18)19-11-13-7-10-15(30-13)24(26)27/h5-11H,3-4H2,1-2H3,(H,20,22,25)/b19-11+ |
| InChIKey | FCWCMUQWSVGKGP-YBFXNURJSA-N |
| XLogP | 3.54 |
| TPSA | 147.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|