C15H12N4O2S2 — CID 45022491
3-methoxy-N-[5-[(E)-thiophen-2-ylmethylideneamino]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 45022491) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-methoxy-N-[5-[(E)-thiophen-2-ylmethylideneamino]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-methoxy-N-[5-[(E)-thiophen-2-ylmethylideneamino]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 45022491 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 3-methoxy-N-[5-[(E)-thiophen-2-ylmethylideneamino]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2nnc(/N=C/c3cccs3)s2)c1 |
| InChI | InChI=1S/C15H12N4O2S2/c1-21-11-5-2-4-10(8-11)13(20)17-15-19-18-14(23-15)16-9-12-6-3-7-22-12/h2-9H,1H3,(H,17,19,20)/b16-9+ |
| InChIKey | MFYVGOHJEFJHRQ-CXUHLZMHSA-N |
| XLogP | 3.61 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|