C18H15N5O7S — CID 4175338
N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide (PubChem CID 4175338) has the molecular formula C18H15N5O7S and a molecular weight of 445.41 g/mol. Its IUPAC name is N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 4175338 |
| Molecular Formula | C18H15N5O7S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3,5-dinitrobenzamide |
| SMILES | COc1ccc(Cc2nnc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)s2)cc1OC |
| InChI | InChI=1S/C18H15N5O7S/c1-29-14-4-3-10(5-15(14)30-2)6-16-20-21-18(31-16)19-17(24)11-7-12(22(25)26)9-13(8-11)23(27)28/h3-5,7-9H,6H2,1-2H3,(H,19,21,24) |
| InChIKey | QECJEJZGQTXZQI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|