C18H15ClN4O5S — CID 4216398
2-chloro-N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide (PubChem CID 4216398) has the molecular formula C18H15ClN4O5S and a molecular weight of 434.86 g/mol. Its IUPAC name is 2-chloro-N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4216398 |
| Molecular Formula | C18H15ClN4O5S |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-chloro-N-[5-[(3,4-dimethoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
| SMILES | COc1ccc(Cc2nnc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)s2)cc1OC |
| InChI | InChI=1S/C18H15ClN4O5S/c1-27-14-6-3-10(7-15(14)28-2)8-16-21-22-18(29-16)20-17(24)12-5-4-11(23(25)26)9-13(12)19/h3-7,9H,8H2,1-2H3,(H,20,22,24) |
| InChIKey | VJXYELNOBQENDK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|