C18H16ClN5O5S2 — CID 17193122
2-chloro-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide (PubChem CID 17193122) has the molecular formula C18H16ClN5O5S2 and a molecular weight of 481.94 g/mol. Its IUPAC name is 2-chloro-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 17193122 |
| Molecular Formula | C18H16ClN5O5S2 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 2-chloro-N-[5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-1,3,4-thiadiazol-2-yl]-4-nitrobenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2nnc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)s2)cc1 |
| InChI | InChI=1S/C18H16ClN5O5S2/c1-11-2-5-13(6-3-11)31(28,29)20-9-8-16-22-23-18(30-16)21-17(25)14-7-4-12(24(26)27)10-15(14)19/h2-7,10,20H,8-9H2,1H3,(H,21,23,25) |
| InChIKey | PVGDWDZAWUNKTF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|