C23H25N3O7S — CID 118707005
3,4,5-trimethoxy-N-[5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 118707005) has the molecular formula C23H25N3O7S and a molecular weight of 487.53 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 118707005 |
| Molecular Formula | C23H25N3O7S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cc(/C=C/c2nnc(NC(=O)c3cc(OC)c(OC)c(OC)c3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25N3O7S/c1-28-15-9-13(10-16(29-2)20(15)32-5)7-8-19-25-26-23(34-19)24-22(27)14-11-17(30-3)21(33-6)18(12-14)31-4/h7-12H,1-6H3,(H,24,26,27)/b8-7+ |
| InChIKey | GYOJVMLQFXYPIX-BQYQJAHWSA-N |
| XLogP | 4.01 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |