C20H19N5O4S — CID 22517783
3,4,5-trimethoxy-N-[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzamide (PubChem CID 22517783) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 22517783 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nn3c(-c4ccc(C)cc4)nnc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19N5O4S/c1-11-5-7-12(8-6-11)17-22-23-20-25(17)24-19(30-20)21-18(26)13-9-14(27-2)16(29-4)15(10-13)28-3/h5-10H,1-4H3,(H,21,24,26) |
| InChIKey | NOIXEXSPKSECJM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |