C19H19N3O4S — CID 35182220
3,4,5-trimethoxy-N-[3-(4-methylphenyl)-1,2,4-thiadiazol-5-yl]benzamide (PubChem CID 35182220) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-(4-methylphenyl)-1,2,4-thiadiazol-5-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-(4-methylphenyl)-1,2,4-thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 35182220 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-(4-methylphenyl)-1,2,4-thiadiazol-5-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nc(-c3ccc(C)cc3)ns2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19N3O4S/c1-11-5-7-12(8-6-11)17-20-19(27-22-17)21-18(23)13-9-14(24-2)16(26-4)15(10-13)25-3/h5-10H,1-4H3,(H,20,21,22,23) |
| InChIKey | IUUNAQZPBZVVDM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |