C15H17N3O5S — CID 53298075
3,4,5-trimethoxy-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide (PubChem CID 53298075) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 53298075 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-(2-oxopropyl)-1,2,4-thiadiazol-5-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nc(CC(C)=O)ns2)cc(OC)c1OC |
| InChI | InChI=1S/C15H17N3O5S/c1-8(19)5-12-16-15(24-18-12)17-14(20)9-6-10(21-2)13(23-4)11(7-9)22-3/h6-7H,5H2,1-4H3,(H,16,17,18,20) |
| InChIKey | WCKSDRPNBSMOLF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |