C17H14BrN3O3S — CID 17013946
4-bromo-N-[3-(3,4-dimethoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide (PubChem CID 17013946) has the molecular formula C17H14BrN3O3S and a molecular weight of 420.29 g/mol. Its IUPAC name is 4-bromo-N-[3-(3,4-dimethoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide.
| Compound Name | 4-bromo-N-[3-(3,4-dimethoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 17013946 |
| Molecular Formula | C17H14BrN3O3S |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | 4-bromo-N-[3-(3,4-dimethoxyphenyl)-1,2,4-thiadiazol-5-yl]benzamide |
| SMILES | COc1ccc(-c2nsc(NC(=O)c3ccc(Br)cc3)n2)cc1OC |
| InChI | InChI=1S/C17H14BrN3O3S/c1-23-13-8-5-11(9-14(13)24-2)15-19-17(25-21-15)20-16(22)10-3-6-12(18)7-4-10/h3-9H,1-2H3,(H,19,20,21,22) |
| InChIKey | INOZKKJBULKWLW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |