C25H31N5O4S — CID 5209711
3,4,5-trimethoxy-N-[5-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 5209711) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[5-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[5-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 5209711 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[5-[2-[4-(4-methylphenyl)piperazin-1-yl]ethyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1cc(C(=O)Nc2nnc(CCN3CCN(c4ccc(C)cc4)CC3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C25H31N5O4S/c1-17-5-7-19(8-6-17)30-13-11-29(12-14-30)10-9-22-27-28-25(35-22)26-24(31)18-15-20(32-2)23(34-4)21(16-18)33-3/h5-8,15-16H,9-14H2,1-4H3,(H,26,28,31) |
| InChIKey | KEENDFXOPHAFRF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|